C17H31N5S — CID 111317118
1-ethyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine (PubChem CID 111317118) has the molecular formula C17H31N5S and a molecular weight of 337.54 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine.
| Compound Name | 1-ethyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111317118 |
| Molecular Formula | C17H31N5S |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 1-ethyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine |
| SMILES | CCN/C(=N\CCc1csc(C)n1)NC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C17H31N5S/c1-5-18-17(19-9-6-16-12-23-14(4)20-16)21-15-7-10-22(11-8-15)13(2)3/h12-13,15H,5-11H2,1-4H3,(H2,18,19,21) |
| InChIKey | ASKOMUAXHCPACM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|