C22H45IN6O2 — CID 111317981
tert-butyl 4-[2-[[ethylamino-[(1-propan-2-ylpiperidin-4-yl)amino]methylidene]amino]ethyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111317981) has the molecular formula C22H45IN6O2 and a molecular weight of 552.55 g/mol. Its IUPAC name is tert-butyl 4-[2-[[ethylamino-[(1-propan-2-ylpiperidin-4-yl)amino]methylidene]amino]ethyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[2-[[ethylamino-[(1-propan-2-ylpiperidin-4-yl)amino]methylidene]amino]ethyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111317981 |
| Molecular Formula | C22H45IN6O2 |
| Molecular Weight | 552.55 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | tert-butyl 4-[2-[[ethylamino-[(1-propan-2-ylpiperidin-4-yl)amino]methylidene]amino]ethyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCN(C(=O)OC(C)(C)C)CC1)NC1CCN(C(C)C)CC1.I |
| InChI | InChI=1S/C22H44N6O2.HI/c1-7-23-20(25-19-8-11-27(12-9-19)18(2)3)24-10-13-26-14-16-28(17-15-26)21(29)30-22(4,5)6;/h18-19H,7-17H2,1-6H3,(H2,23,24,25);1H |
| InChIKey | GDQSOQAIVBIILU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.55 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|