C16H33N5O — CID 111318000
3-[[ethylamino-[(1-propan-2-ylpiperidin-4-yl)amino]methylidene]amino]-2,2-dimethylpropanamide (PubChem CID 111318000) has the molecular formula C16H33N5O and a molecular weight of 311.47 g/mol. Its IUPAC name is 3-[[ethylamino-[(1-propan-2-ylpiperidin-4-yl)amino]methylidene]amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[[ethylamino-[(1-propan-2-ylpiperidin-4-yl)amino]methylidene]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111318000 |
| Molecular Formula | C16H33N5O |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.27 |
| IUPAC Name | 3-[[ethylamino-[(1-propan-2-ylpiperidin-4-yl)amino]methylidene]amino]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\CC(C)(C)C(N)=O)NC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C16H33N5O/c1-6-18-15(19-11-16(4,5)14(17)22)20-13-7-9-21(10-8-13)12(2)3/h12-13H,6-11H2,1-5H3,(H2,17,22)(H2,18,19,20) |
| InChIKey | MPCNSGFDNQAABM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|