C22H39IN4O — CID 111318069
2-[(3-butoxyphenyl)methyl]-1-ethyl-3-(1-propan-2-ylpiperidin-4-yl)guanidine;hydroiodide (PubChem CID 111318069) has the molecular formula C22H39IN4O and a molecular weight of 502.49 g/mol. Its IUPAC name is 2-[(3-butoxyphenyl)methyl]-1-ethyl-3-(1-propan-2-ylpiperidin-4-yl)guanidine;hydroiodide.
| Compound Name | 2-[(3-butoxyphenyl)methyl]-1-ethyl-3-(1-propan-2-ylpiperidin-4-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111318069 |
| Molecular Formula | C22H39IN4O |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 2-[(3-butoxyphenyl)methyl]-1-ethyl-3-(1-propan-2-ylpiperidin-4-yl)guanidine;hydroiodide |
| SMILES | CCCCOc1cccc(C/N=C(\NCC)NC2CCN(C(C)C)CC2)c1.I |
| InChI | InChI=1S/C22H38N4O.HI/c1-5-7-15-27-21-10-8-9-19(16-21)17-24-22(23-6-2)25-20-11-13-26(14-12-20)18(3)4;/h8-10,16,18,20H,5-7,11-15,17H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | UDDJXUUBFSOPEQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|