C16H32F3N5 — CID 111318242
2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine (PubChem CID 111318242) has the molecular formula C16H32F3N5 and a molecular weight of 351.46 g/mol. Its IUPAC name is 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine.
| Compound Name | 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111318242 |
| Molecular Formula | C16H32F3N5 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)NC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C16H32F3N5/c1-13(2)24-10-6-14(7-11-24)22-15(20-3)21-8-5-9-23(4)12-16(17,18)19/h13-14H,5-12H2,1-4H3,(H2,20,21,22) |
| InChIKey | ORRKRWXEVKUPLR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|