C20H43IN6 — CID 111320017
1-ethyl-3-[2-(4-methylpiperazin-1-yl)propyl]-2-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111320017) has the molecular formula C20H43IN6 and a molecular weight of 494.51 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methylpiperazin-1-yl)propyl]-2-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(4-methylpiperazin-1-yl)propyl]-2-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111320017 |
| Molecular Formula | C20H43IN6 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 1-ethyl-3-[2-(4-methylpiperazin-1-yl)propyl]-2-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)N1CCCCC1)NCC(C)N1CCN(C)CC1.I |
| InChI | InChI=1S/C20H42N6.HI/c1-6-21-19(22-16-18(2)25-14-12-24(5)13-15-25)23-17-20(3,4)26-10-8-7-9-11-26;/h18H,6-17H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | VPZRDVIVZKKZDJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 46.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|