C21H36N4O2S — CID 111321130
1-(3-benzylsulfonylpropyl)-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine (PubChem CID 111321130) has the molecular formula C21H36N4O2S and a molecular weight of 408.61 g/mol. Its IUPAC name is 1-(3-benzylsulfonylpropyl)-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine.
| Compound Name | 1-(3-benzylsulfonylpropyl)-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111321130 |
| Molecular Formula | C21H36N4O2S |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 1-(3-benzylsulfonylpropyl)-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine |
| SMILES | C/N=C(\NCCCS(=O)(=O)Cc1ccccc1)NCC(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C21H36N4O2S/c1-21(2,25-14-8-5-9-15-25)18-24-20(22-3)23-13-10-16-28(26,27)17-19-11-6-4-7-12-19/h4,6-7,11-12H,5,8-10,13-18H2,1-3H3,(H2,22,23,24) |
| InChIKey | PTXIPAFETYFQCJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|