C18H32IN5O — CID 111321349
1-[(2-methoxy-4-pyridinyl)methyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111321349) has the molecular formula C18H32IN5O and a molecular weight of 461.39 g/mol. Its IUPAC name is 1-[(2-methoxy-4-pyridinyl)methyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[(2-methoxy-4-pyridinyl)methyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111321349 |
| Molecular Formula | C18H32IN5O |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 1-[(2-methoxy-4-pyridinyl)methyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccnc(OC)c1)NCC(C)(C)N1CCCCC1.I |
| InChI | InChI=1S/C18H31N5O.HI/c1-18(2,23-10-6-5-7-11-23)14-22-17(19-3)21-13-15-8-9-20-16(12-15)24-4;/h8-9,12H,5-7,10-11,13-14H2,1-4H3,(H2,19,21,22);1H |
| InChIKey | YGSSBHCNJVAVPR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|