C20H31NO3Si — CID 11132182
tert-butyl (4R)-4-[(E)-2-[dimethyl(phenyl)silyl]ethenyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11132182) has the molecular formula C20H31NO3Si and a molecular weight of 361.56 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(E)-2-[dimethyl(phenyl)silyl]ethenyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(E)-2-[dimethyl(phenyl)silyl]ethenyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11132182 |
| Molecular Formula | C20H31NO3Si |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | tert-butyl (4R)-4-[(E)-2-[dimethyl(phenyl)silyl]ethenyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](/C=C/[Si](C)(C)c2ccccc2)COC1(C)C |
| InChI | InChI=1S/C20H31NO3Si/c1-19(2,3)24-18(22)21-16(15-23-20(21,4)5)13-14-25(6,7)17-11-9-8-10-12-17/h8-14,16H,15H2,1-7H3/b14-13+/t16-/m1/s1 |
| InChIKey | ACHUECNZWVZSQP-FIFPYPGSSA-N |
| XLogP | 4.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|