C18H18N8O — CID 1113227
4-[4,5-bis(anilinomethyl)triazol-1-yl]-1,2,5-oxadiazol-3-amine (PubChem CID 1113227) has the molecular formula C18H18N8O and a molecular weight of 362.40 g/mol. Its IUPAC name is 4-[4,5-bis(anilinomethyl)triazol-1-yl]-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-[4,5-bis(anilinomethyl)triazol-1-yl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 1113227 |
| Molecular Formula | C18H18N8O |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 4-[4,5-bis(anilinomethyl)triazol-1-yl]-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1-n1nnc(CNc2ccccc2)c1CNc1ccccc1 |
| InChI | InChI=1S/C18H18N8O/c19-17-18(24-27-23-17)26-16(12-21-14-9-5-2-6-10-14)15(22-25-26)11-20-13-7-3-1-4-8-13/h1-10,20-21H,11-12H2,(H2,19,23) |
| InChIKey | ICTWYANBIGDSHY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |