C24H32IN7O — CID 111322923
1-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111322923) has the molecular formula C24H32IN7O and a molecular weight of 561.47 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111322923 |
| Molecular Formula | C24H32IN7O |
| Molecular Weight | 561.47 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | 1-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nncn1-c1ccccc1)NCC(c1ccccc1OC)N1CCCC1.I |
| InChI | InChI=1S/C24H31N7O.HI/c1-25-24(27-17-23-29-28-18-31(23)19-10-4-3-5-11-19)26-16-21(30-14-8-9-15-30)20-12-6-7-13-22(20)32-2;/h3-7,10-13,18,21H,8-9,14-17H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | HKNHIQMGLDPUSM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|