C23H41IN6O — CID 111322969
1-[2-(4-ethylpiperazin-1-yl)ethyl]-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide (PubChem CID 111322969) has the molecular formula C23H41IN6O and a molecular weight of 544.53 g/mol. Its IUPAC name is 1-[2-(4-ethylpiperazin-1-yl)ethyl]-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-ethylpiperazin-1-yl)ethyl]-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111322969 |
| Molecular Formula | C23H41IN6O |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 1-[2-(4-ethylpiperazin-1-yl)ethyl]-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN1CCN(CCN/C(=N\C)NCC(c2ccccc2OC)N2CCCC2)CC1.I |
| InChI | InChI=1S/C23H40N6O.HI/c1-4-27-15-17-28(18-16-27)14-11-25-23(24-2)26-19-21(29-12-7-8-13-29)20-9-5-6-10-22(20)30-3;/h5-6,9-10,21H,4,7-8,11-19H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | HPCIKVTVNFHVAE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|