About (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpent-2-enal
(E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpent-2-enal (PubChem CID 11132305) has the molecular formula C23H30O2Si
and a molecular weight of 366.58 g/mol. Its IUPAC name is (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpent-2-enal.
Molecular Properties
| Compound Name | (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpent-2-enal |
| PubChem CID | 11132305 |
| Molecular Formula | C23H30O2Si |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpent-2-enal |
| SMILES | C/C(C=O)=C\[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H30O2Si/c1-19(17-24)16-20(2)18-25-26(23(3,4)5,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-17,20H,18H2,1-5H3/b19-16+/t20-/m0/s1 |
| InChIKey | KYMJZAYLXKYBCJ-UETJRYKRSA-N |
| XLogP | 4.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpent-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpent-2-enal?
The IUPAC name of (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpent-2-enal (CID 11132305) is (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpent-2-enal.
What is the SMILES notation for (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpent-2-enal?
The canonical SMILES for (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpent-2-enal is C/C(C=O)=C\[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpent-2-enal?
The InChIKey is KYMJZAYLXKYBCJ-UETJRYKRSA-N. The full InChI is InChI=1S/C23H30O2Si/c1-19(17-24)16-20(2)18-25-26(23(3,4)5,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-17,20H,18H2,1-5H3/b19-16+/t20-/m0/s1.
What are the key properties of (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpent-2-enal?
(E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpent-2-enal has a molecular weight of 366.58 g/mol, XLogP of 4.34, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpent-2-enal is sourced from PubChem (CID 11132305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).