C20H18O7 — CID 11132387
ethyl 8-(2-ethoxy-2-oxoethoxy)-10-formyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaene-3-carboxylate (PubChem CID 11132387) has the molecular formula C20H18O7 and a molecular weight of 370.36 g/mol. Its IUPAC name is ethyl 8-(2-ethoxy-2-oxoethoxy)-10-formyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaene-3-carboxylate.
| Compound Name | ethyl 8-(2-ethoxy-2-oxoethoxy)-10-formyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaene-3-carboxylate |
|---|---|
| PubChem CID | 11132387 |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | ethyl 8-(2-ethoxy-2-oxoethoxy)-10-formyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaene-3-carboxylate |
| SMILES | CCOC(=O)COc1ccc2c3c(ccc(C=O)c13)OC(C(=O)OCC)=C2 |
| InChI | InChI=1S/C20H18O7/c1-3-24-17(22)11-26-14-7-5-12-9-16(20(23)25-4-2)27-15-8-6-13(10-21)19(14)18(12)15/h5-10H,3-4,11H2,1-2H3 |
| InChIKey | OQJUBZWMDUBHFP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|