C23H30F2N4O — CID 111324306
1-[1-(3,4-difluorophenyl)ethyl]-2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-3-ethylguanidine (PubChem CID 111324306) has the molecular formula C23H30F2N4O and a molecular weight of 416.52 g/mol. Its IUPAC name is 1-[1-(3,4-difluorophenyl)ethyl]-2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-3-ethylguanidine.
| Compound Name | 1-[1-(3,4-difluorophenyl)ethyl]-2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111324306 |
| Molecular Formula | C23H30F2N4O |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 1-[1-(3,4-difluorophenyl)ethyl]-2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(O)CN1CCc2ccccc2C1)NC(C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H30F2N4O/c1-3-26-23(28-16(2)18-8-9-21(24)22(25)12-18)27-13-20(30)15-29-11-10-17-6-4-5-7-19(17)14-29/h4-9,12,16,20,30H,3,10-11,13-15H2,1-2H3,(H2,26,27,28) |
| InChIKey | HRHPEHTUDSROLJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|