C21H36IN5O — CID 111324457
3-[[[[3-(azepan-1-yl)propylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide (PubChem CID 111324457) has the molecular formula C21H36IN5O and a molecular weight of 501.46 g/mol. Its IUPAC name is 3-[[[[3-(azepan-1-yl)propylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[[[[3-(azepan-1-yl)propylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111324457 |
| Molecular Formula | C21H36IN5O |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 3-[[[[3-(azepan-1-yl)propylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC)c1)NCCCN1CCCCCC1.I |
| InChI | InChI=1S/C21H35N5O.HI/c1-3-23-21(24-12-9-15-26-13-6-4-5-7-14-26)25-17-18-10-8-11-19(16-18)20(27)22-2;/h8,10-11,16H,3-7,9,12-15,17H2,1-2H3,(H,22,27)(H2,23,24,25);1H |
| InChIKey | CIAXYTAROVJBED-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|