About (6-bromo-2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(3-fluorophenyl)methanone
(6-bromo-2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(3-fluorophenyl)methanone (PubChem CID 11132658) has the molecular formula C17H15BrFNOS
and a molecular weight of 380.28 g/mol. Its IUPAC name is (6-bromo-2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(3-fluorophenyl)methanone.
Molecular Properties
| Compound Name | (6-bromo-2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(3-fluorophenyl)methanone |
| PubChem CID | 11132658 |
| Molecular Formula | C17H15BrFNOS |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | (6-bromo-2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(3-fluorophenyl)methanone |
| SMILES | CC1(C)CN(C(=O)c2cccc(F)c2)c2cc(Br)ccc2S1 |
| InChI | InChI=1S/C17H15BrFNOS/c1-17(2)10-20(14-9-12(18)6-7-15(14)22-17)16(21)11-4-3-5-13(19)8-11/h3-9H,10H2,1-2H3 |
| InChIKey | REVXJRYWRNJLPV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-bromo-2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(3-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(3-fluorophenyl)methanone?
The IUPAC name of (6-bromo-2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(3-fluorophenyl)methanone (CID 11132658) is (6-bromo-2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(3-fluorophenyl)methanone.
What is the SMILES notation for (6-bromo-2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(3-fluorophenyl)methanone?
The canonical SMILES for (6-bromo-2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(3-fluorophenyl)methanone is CC1(C)CN(C(=O)c2cccc(F)c2)c2cc(Br)ccc2S1.
What is the InChIKey of (6-bromo-2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(3-fluorophenyl)methanone?
The InChIKey is REVXJRYWRNJLPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15BrFNOS/c1-17(2)10-20(14-9-12(18)6-7-15(14)22-17)16(21)11-4-3-5-13(19)8-11/h3-9H,10H2,1-2H3.
What are the key properties of (6-bromo-2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(3-fluorophenyl)methanone?
(6-bromo-2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(3-fluorophenyl)methanone has a molecular weight of 380.28 g/mol, XLogP of 5.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(3-fluorophenyl)methanone is sourced from PubChem (CID 11132658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).