C16H28N6O2 — CID 111327788
ethyl 4-[[N-(3-imidazol-1-ylpropyl)-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111327788) has the molecular formula C16H28N6O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is ethyl 4-[[N-(3-imidazol-1-ylpropyl)-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-(3-imidazol-1-ylpropyl)-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111327788 |
| Molecular Formula | C16H28N6O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | ethyl 4-[[N-(3-imidazol-1-ylpropyl)-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCCCn2ccnc2)CC1 |
| InChI | InChI=1S/C16H28N6O2/c1-3-24-16(23)22-10-5-14(6-11-22)20-15(17-2)19-7-4-9-21-12-8-18-13-21/h8,12-14H,3-7,9-11H2,1-2H3,(H2,17,19,20) |
| InChIKey | CEXVEEQKJKOQSX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|