C24H38O4 — CID 11132920
(2S,3S)-2-[(2S,3Z,6S,7R,8S,9S,10S,11Z)-7,9-dihydroxy-4,6,8,10-tetramethyltetradeca-3,11,13-trien-2-yl]-3-methyl-2,3-dihydropyran-6-one (PubChem CID 11132920) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is (2S,3S)-2-[(2S,3Z,6S,7R,8S,9S,10S,11Z)-7,9-dihydroxy-4,6,8,10-tetramethyltetradeca-3,11,13-trien-2-yl]-3-methyl-2,3-dihydropyran-6-one.
| Compound Name | (2S,3S)-2-[(2S,3Z,6S,7R,8S,9S,10S,11Z)-7,9-dihydroxy-4,6,8,10-tetramethyltetradeca-3,11,13-trien-2-yl]-3-methyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11132920 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | (2S,3S)-2-[(2S,3Z,6S,7R,8S,9S,10S,11Z)-7,9-dihydroxy-4,6,8,10-tetramethyltetradeca-3,11,13-trien-2-yl]-3-methyl-2,3-dihydropyran-6-one |
| SMILES | C=C/C=C\[C@H](C)[C@H](O)[C@@H](C)[C@H](O)[C@@H](C)C/C(C)=C\[C@H](C)[C@H]1OC(=O)C=C[C@@H]1C |
| InChI | InChI=1S/C24H38O4/c1-8-9-10-16(3)22(26)20(7)23(27)18(5)13-15(2)14-19(6)24-17(4)11-12-21(25)28-24/h8-12,14,16-20,22-24,26-27H,1,13H2,2-7H3/b10-9-,15-14-/t16-,17-,18-,19-,20+,22-,23+,24-/m0/s1 |
| InChIKey | CODXOZUBSINYKM-LSHFNGLVSA-N |
| XLogP | 4.45 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|