About 1-[3-[(4-amino-5-fluoro-2-methylquinolin-3-yl)methoxymethyl]phenyl]-2,2,2-trifluoroethanone
1-[3-[(4-amino-5-fluoro-2-methylquinolin-3-yl)methoxymethyl]phenyl]-2,2,2-trifluoroethanone (PubChem CID 11132948) has the molecular formula C20H16F4N2O2
and a molecular weight of 392.35 g/mol. Its IUPAC name is 1-[3-[(4-amino-5-fluoro-2-methylquinolin-3-yl)methoxymethyl]phenyl]-2,2,2-trifluoroethanone.
Molecular Properties
| Compound Name | 1-[3-[(4-amino-5-fluoro-2-methylquinolin-3-yl)methoxymethyl]phenyl]-2,2,2-trifluoroethanone |
| PubChem CID | 11132948 |
| Molecular Formula | C20H16F4N2O2 |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 1-[3-[(4-amino-5-fluoro-2-methylquinolin-3-yl)methoxymethyl]phenyl]-2,2,2-trifluoroethanone |
| SMILES | Cc1nc2cccc(F)c2c(N)c1COCc1cccc(C(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F4N2O2/c1-11-14(18(25)17-15(21)6-3-7-16(17)26-11)10-28-9-12-4-2-5-13(8-12)19(27)20(22,23)24/h2-8H,9-10H2,1H3,(H2,25,26) |
| InChIKey | FETZSOAPEQTBLT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-[(4-amino-5-fluoro-2-methylquinolin-3-yl)methoxymethyl]phenyl]-2,2,2-trifluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(4-amino-5-fluoro-2-methylquinolin-3-yl)methoxymethyl]phenyl]-2,2,2-trifluoroethanone?
The IUPAC name of 1-[3-[(4-amino-5-fluoro-2-methylquinolin-3-yl)methoxymethyl]phenyl]-2,2,2-trifluoroethanone (CID 11132948) is 1-[3-[(4-amino-5-fluoro-2-methylquinolin-3-yl)methoxymethyl]phenyl]-2,2,2-trifluoroethanone.
What is the SMILES notation for 1-[3-[(4-amino-5-fluoro-2-methylquinolin-3-yl)methoxymethyl]phenyl]-2,2,2-trifluoroethanone?
The canonical SMILES for 1-[3-[(4-amino-5-fluoro-2-methylquinolin-3-yl)methoxymethyl]phenyl]-2,2,2-trifluoroethanone is Cc1nc2cccc(F)c2c(N)c1COCc1cccc(C(=O)C(F)(F)F)c1.
What is the InChIKey of 1-[3-[(4-amino-5-fluoro-2-methylquinolin-3-yl)methoxymethyl]phenyl]-2,2,2-trifluoroethanone?
The InChIKey is FETZSOAPEQTBLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F4N2O2/c1-11-14(18(25)17-15(21)6-3-7-16(17)26-11)10-28-9-12-4-2-5-13(8-12)19(27)20(22,23)24/h2-8H,9-10H2,1H3,(H2,25,26).
What are the key properties of 1-[3-[(4-amino-5-fluoro-2-methylquinolin-3-yl)methoxymethyl]phenyl]-2,2,2-trifluoroethanone?
1-[3-[(4-amino-5-fluoro-2-methylquinolin-3-yl)methoxymethyl]phenyl]-2,2,2-trifluoroethanone has a molecular weight of 392.35 g/mol, XLogP of 4.73, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(4-amino-5-fluoro-2-methylquinolin-3-yl)methoxymethyl]phenyl]-2,2,2-trifluoroethanone is sourced from PubChem (CID 11132948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).