About 1-phenyl-1-(triphenyl-λ5-phosphanylidene)propan-2-one
1-phenyl-1-(triphenyl-λ5-phosphanylidene)propan-2-one (PubChem CID 11132996) has the molecular formula C27H23OP
and a molecular weight of 394.45 g/mol. Its IUPAC name is 1-phenyl-1-(triphenyl-λ5-phosphanylidene)propan-2-one.
Molecular Properties
| Compound Name | 1-phenyl-1-(triphenyl-λ5-phosphanylidene)propan-2-one |
| PubChem CID | 11132996 |
| Molecular Formula | C27H23OP |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1-phenyl-1-(triphenyl-λ5-phosphanylidene)propan-2-one |
| SMILES | CC(=O)C(c1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H23OP/c1-22(28)27(23-14-6-2-7-15-23)29(24-16-8-3-9-17-24,25-18-10-4-11-19-25)26-20-12-5-13-21-26/h2-21H,1H3 |
| InChIKey | DGBCOJKSVMQZPP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-1-(triphenyl-λ5-phosphanylidene)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-1-(triphenyl-λ5-phosphanylidene)propan-2-one?
The IUPAC name of 1-phenyl-1-(triphenyl-λ5-phosphanylidene)propan-2-one (CID 11132996) is 1-phenyl-1-(triphenyl-λ5-phosphanylidene)propan-2-one.
What is the SMILES notation for 1-phenyl-1-(triphenyl-λ5-phosphanylidene)propan-2-one?
The canonical SMILES for 1-phenyl-1-(triphenyl-λ5-phosphanylidene)propan-2-one is CC(=O)C(c1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-phenyl-1-(triphenyl-λ5-phosphanylidene)propan-2-one?
The InChIKey is DGBCOJKSVMQZPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23OP/c1-22(28)27(23-14-6-2-7-15-23)29(24-16-8-3-9-17-24,25-18-10-4-11-19-25)26-20-12-5-13-21-26/h2-21H,1H3.
What are the key properties of 1-phenyl-1-(triphenyl-λ5-phosphanylidene)propan-2-one?
1-phenyl-1-(triphenyl-λ5-phosphanylidene)propan-2-one has a molecular weight of 394.45 g/mol, XLogP of 4.79, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-1-(triphenyl-λ5-phosphanylidene)propan-2-one is sourced from PubChem (CID 11132996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).