C24H29NO4 — CID 11133027
tert-butyl N-benzyl-N-[(1S)-1-[(2S)-5-oxooxolan-2-yl]-2-phenylethyl]carbamate (PubChem CID 11133027) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(1S)-1-[(2S)-5-oxooxolan-2-yl]-2-phenylethyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(1S)-1-[(2S)-5-oxooxolan-2-yl]-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 11133027 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | tert-butyl N-benzyl-N-[(1S)-1-[(2S)-5-oxooxolan-2-yl]-2-phenylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccccc1)[C@@H](Cc1ccccc1)[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C24H29NO4/c1-24(2,3)29-23(27)25(17-19-12-8-5-9-13-19)20(21-14-15-22(26)28-21)16-18-10-6-4-7-11-18/h4-13,20-21H,14-17H2,1-3H3/t20-,21-/m0/s1 |
| InChIKey | HVCNSBFHCLRTLE-SFTDATJTSA-N |
| XLogP | 4.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |