C22H44O2Si2 — CID 11133057
2-[[(1S,7S,7aR)-7a-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methyl-1,2,3,5,6,7-hexahydroinden-1-yl]oxy]ethyl-trimethylsilane (PubChem CID 11133057) has the molecular formula C22H44O2Si2 and a molecular weight of 396.76 g/mol. Its IUPAC name is 2-[[(1S,7S,7aR)-7a-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methyl-1,2,3,5,6,7-hexahydroinden-1-yl]oxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(1S,7S,7aR)-7a-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methyl-1,2,3,5,6,7-hexahydroinden-1-yl]oxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 11133057 |
| Molecular Formula | C22H44O2Si2 |
| Molecular Weight | 396.76 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | 2-[[(1S,7S,7aR)-7a-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methyl-1,2,3,5,6,7-hexahydroinden-1-yl]oxy]ethyl-trimethylsilane |
| SMILES | C[C@H]1CCC=C2CC[C@H](OCC[Si](C)(C)C)[C@@]21CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O2Si2/c1-18-11-10-12-19-13-14-20(23-15-16-25(5,6)7)22(18,19)17-24-26(8,9)21(2,3)4/h12,18,20H,10-11,13-17H2,1-9H3/t18-,20-,22+/m0/s1 |
| InChIKey | WMMJQMFAVWYVCH-RCZSKKKRSA-N |
| XLogP | 6.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.76 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|