C18H18F2N4O5 — CID 11133303
(E)-1-[2-[4-(1,3-difluoropropan-2-yloxy)pyrimidin-2-yl]oxyphenyl]-1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxymethanimine (PubChem CID 11133303) has the molecular formula C18H18F2N4O5 and a molecular weight of 408.36 g/mol. Its IUPAC name is (E)-1-[2-[4-(1,3-difluoropropan-2-yloxy)pyrimidin-2-yl]oxyphenyl]-1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxymethanimine.
| Compound Name | (E)-1-[2-[4-(1,3-difluoropropan-2-yloxy)pyrimidin-2-yl]oxyphenyl]-1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxymethanimine |
|---|---|
| PubChem CID | 11133303 |
| Molecular Formula | C18H18F2N4O5 |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | (E)-1-[2-[4-(1,3-difluoropropan-2-yloxy)pyrimidin-2-yl]oxyphenyl]-1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxymethanimine |
| SMILES | CO/N=C(/C1=NOCCO1)c1ccccc1Oc1nccc(OC(CF)CF)n1 |
| InChI | InChI=1S/C18H18F2N4O5/c1-25-23-16(17-24-27-9-8-26-17)13-4-2-3-5-14(13)29-18-21-7-6-15(22-18)28-12(10-19)11-20/h2-7,12H,8-11H2,1H3/b23-16+ |
| InChIKey | YUIOOGGTZAGJJC-XQNSMLJCSA-N |
| XLogP | 2.67 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|