C25H32O3Si — CID 11133322
(1R,3R,12bS)-1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1,2,3,4,6,12b-hexahydrobenzo[a]anthracene-7,12-dione (PubChem CID 11133322) has the molecular formula C25H32O3Si and a molecular weight of 408.61 g/mol. Its IUPAC name is (1R,3R,12bS)-1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1,2,3,4,6,12b-hexahydrobenzo[a]anthracene-7,12-dione.
| Compound Name | (1R,3R,12bS)-1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1,2,3,4,6,12b-hexahydrobenzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 11133322 |
| Molecular Formula | C25H32O3Si |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (1R,3R,12bS)-1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1,2,3,4,6,12b-hexahydrobenzo[a]anthracene-7,12-dione |
| SMILES | C[C@@H]1CC2=CCC3=C(C(=O)c4ccccc4C3=O)[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C25H32O3Si/c1-15-13-16-11-12-19-22(24(27)18-10-8-7-9-17(18)23(19)26)21(16)20(14-15)28-29(5,6)25(2,3)4/h7-11,15,20-21H,12-14H2,1-6H3/t15-,20-,21-/m1/s1 |
| InChIKey | FQORCCGNBFTRBV-IPHXSNPTSA-N |
| XLogP | 6.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|