C15H17NO3 — CID 111335077
N-(2-hydroxy-2-phenylpropyl)-3-methylfuran-2-carboxamide (PubChem CID 111335077) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is N-(2-hydroxy-2-phenylpropyl)-3-methylfuran-2-carboxamide.
| Compound Name | N-(2-hydroxy-2-phenylpropyl)-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 111335077 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-(2-hydroxy-2-phenylpropyl)-3-methylfuran-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)NCC(C)(O)c1ccccc1 |
| InChI | InChI=1S/C15H17NO3/c1-11-8-9-19-13(11)14(17)16-10-15(2,18)12-6-4-3-5-7-12/h3-9,18H,10H2,1-2H3,(H,16,17) |
| InChIKey | NQTQQGVFFOXTPO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |