C20H26N2O3 — CID 111335702
1-(2-hydroxy-2-phenylpropyl)-3-[1-(4-methoxyphenyl)propyl]urea (PubChem CID 111335702) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-(2-hydroxy-2-phenylpropyl)-3-[1-(4-methoxyphenyl)propyl]urea.
| Compound Name | 1-(2-hydroxy-2-phenylpropyl)-3-[1-(4-methoxyphenyl)propyl]urea |
|---|---|
| PubChem CID | 111335702 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-(2-hydroxy-2-phenylpropyl)-3-[1-(4-methoxyphenyl)propyl]urea |
| SMILES | CCC(NC(=O)NCC(C)(O)c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H26N2O3/c1-4-18(15-10-12-17(25-3)13-11-15)22-19(23)21-14-20(2,24)16-8-6-5-7-9-16/h5-13,18,24H,4,14H2,1-3H3,(H2,21,22,23) |
| InChIKey | ZSZWOKXTUXUGKP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |