C21H40O8 — CID 11133574
(3R,4S,5S,6R,7R,9R,10S,11S,12R,13S,14R)-14-ethyl-4,6,7,10,12,13-hexahydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2-one (PubChem CID 11133574) has the molecular formula C21H40O8 and a molecular weight of 420.54 g/mol. Its IUPAC name is (3R,4S,5S,6R,7R,9R,10S,11S,12R,13S,14R)-14-ethyl-4,6,7,10,12,13-hexahydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2-one.
| Compound Name | (3R,4S,5S,6R,7R,9R,10S,11S,12R,13S,14R)-14-ethyl-4,6,7,10,12,13-hexahydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2-one |
|---|---|
| PubChem CID | 11133574 |
| Molecular Formula | C21H40O8 |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | (3R,4S,5S,6R,7R,9R,10S,11S,12R,13S,14R)-14-ethyl-4,6,7,10,12,13-hexahydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2-one |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O)[C@H](C)[C@@H](O)[C@](C)(O)C[C@@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C21H40O8/c1-8-14-21(7,28)18(25)11(3)15(22)10(2)9-20(6,27)17(24)12(4)16(23)13(5)19(26)29-14/h10-18,22-25,27-28H,8-9H2,1-7H3/t10-,11+,12+,13-,14-,15+,16+,17-,18-,20-,21-/m1/s1 |
| InChIKey | FKRHDTMYHGOWPW-JODWSDJDSA-N |
| XLogP | 0.20 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |