C23H19NO5S — CID 11133598
(4R,5S)-4-benzoyl-3-(4-methylphenyl)sulfonyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 11133598) has the molecular formula C23H19NO5S and a molecular weight of 421.47 g/mol. Its IUPAC name is (4R,5S)-4-benzoyl-3-(4-methylphenyl)sulfonyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-4-benzoyl-3-(4-methylphenyl)sulfonyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11133598 |
| Molecular Formula | C23H19NO5S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | (4R,5S)-4-benzoyl-3-(4-methylphenyl)sulfonyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)O[C@@H](c3ccccc3)[C@@H]2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19NO5S/c1-16-12-14-19(15-13-16)30(27,28)24-20(21(25)17-8-4-2-5-9-17)22(29-23(24)26)18-10-6-3-7-11-18/h2-15,20,22H,1H3/t20-,22-/m0/s1 |
| InChIKey | OPPHCAPVRGNKGR-UNMCSNQZSA-N |
| XLogP | 4.13 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |