C14H22N2O3 — CID 111337159
1-(3-hydroxybutyl)-3-[[2-(methoxymethyl)phenyl]methyl]urea (PubChem CID 111337159) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-(3-hydroxybutyl)-3-[[2-(methoxymethyl)phenyl]methyl]urea.
| Compound Name | 1-(3-hydroxybutyl)-3-[[2-(methoxymethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 111337159 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-(3-hydroxybutyl)-3-[[2-(methoxymethyl)phenyl]methyl]urea |
| SMILES | COCc1ccccc1CNC(=O)NCCC(C)O |
| InChI | InChI=1S/C14H22N2O3/c1-11(17)7-8-15-14(18)16-9-12-5-3-4-6-13(12)10-19-2/h3-6,11,17H,7-10H2,1-2H3,(H2,15,16,18) |
| InChIKey | WGIQDSRSARKDCB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |