C28H28O4 — CID 11133739
dimethyl 10,11-diphenyltetracyclo[6.4.0.04,12.05,9]dodec-10-ene-9,12-dicarboxylate (PubChem CID 11133739) has the molecular formula C28H28O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is dimethyl 10,11-diphenyltetracyclo[6.4.0.04,12.05,9]dodec-10-ene-9,12-dicarboxylate.
| Compound Name | dimethyl 10,11-diphenyltetracyclo[6.4.0.04,12.05,9]dodec-10-ene-9,12-dicarboxylate |
|---|---|
| PubChem CID | 11133739 |
| Molecular Formula | C28H28O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | dimethyl 10,11-diphenyltetracyclo[6.4.0.04,12.05,9]dodec-10-ene-9,12-dicarboxylate |
| SMILES | COC(=O)C12C(c3ccccc3)=C(c3ccccc3)C3(C(=O)OC)C4CCC3C1CCC42 |
| InChI | InChI=1S/C28H28O4/c1-31-25(29)27-19-13-14-20(27)22-16-15-21(19)28(22,26(30)32-2)24(18-11-7-4-8-12-18)23(27)17-9-5-3-6-10-17/h3-12,19-22H,13-16H2,1-2H3 |
| InChIKey | IWXBNVQVGQXAGW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|