C29H48O2 — CID 11133747
2-[(3E,7E,11E,15E)-3,7,12,16,20-pentamethylhenicosa-3,7,11,15,19-pentaenyl]-1,3-dioxolane (PubChem CID 11133747) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is 2-[(3E,7E,11E,15E)-3,7,12,16,20-pentamethylhenicosa-3,7,11,15,19-pentaenyl]-1,3-dioxolane.
| Compound Name | 2-[(3E,7E,11E,15E)-3,7,12,16,20-pentamethylhenicosa-3,7,11,15,19-pentaenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 11133747 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | 2-[(3E,7E,11E,15E)-3,7,12,16,20-pentamethylhenicosa-3,7,11,15,19-pentaenyl]-1,3-dioxolane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC1OCCO1 |
| InChI | InChI=1S/C29H48O2/c1-24(2)12-9-15-27(5)18-10-16-25(3)13-7-8-14-26(4)17-11-19-28(6)20-21-29-30-22-23-31-29/h12-14,18-19,29H,7-11,15-17,20-23H2,1-6H3/b25-13+,26-14+,27-18+,28-19+ |
| InChIKey | KOHGEBHPCNVOAB-QOEMZADFSA-N |
| XLogP | 9.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|