C12H22N2O3 — CID 111337512
1-[(4-hydroxyoxan-4-yl)methyl]-3-[(E)-pent-3-enyl]urea (PubChem CID 111337512) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-[(4-hydroxyoxan-4-yl)methyl]-3-[(E)-pent-3-enyl]urea.
| Compound Name | 1-[(4-hydroxyoxan-4-yl)methyl]-3-[(E)-pent-3-enyl]urea |
|---|---|
| PubChem CID | 111337512 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 1-[(4-hydroxyoxan-4-yl)methyl]-3-[(E)-pent-3-enyl]urea |
| SMILES | C/C=C/CCNC(=O)NCC1(O)CCOCC1 |
| InChI | InChI=1S/C12H22N2O3/c1-2-3-4-7-13-11(15)14-10-12(16)5-8-17-9-6-12/h2-3,16H,4-10H2,1H3,(H2,13,14,15)/b3-2+ |
| InChIKey | PWGOMOCCHDLTPC-NSCUHMNNSA-N |
| XLogP | 0.79 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|