C13H19IO8 — CID 11133767
[(2S,3S,4S,5R,6S)-4,5-diacetyloxy-2-(iodomethyl)-6-methoxyoxan-3-yl] acetate (PubChem CID 11133767) has the molecular formula C13H19IO8 and a molecular weight of 430.19 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-4,5-diacetyloxy-2-(iodomethyl)-6-methoxyoxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S,5R,6S)-4,5-diacetyloxy-2-(iodomethyl)-6-methoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 11133767 |
| Molecular Formula | C13H19IO8 |
| Molecular Weight | 430.19 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-4,5-diacetyloxy-2-(iodomethyl)-6-methoxyoxan-3-yl] acetate |
| SMILES | CO[C@H]1O[C@H](CI)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C13H19IO8/c1-6(15)19-10-9(5-14)22-13(18-4)12(21-8(3)17)11(10)20-7(2)16/h9-13H,5H2,1-4H3/t9-,10-,11+,12-,13+/m1/s1 |
| InChIKey | WKINNAVZJINYDX-LBELIVKGSA-N |
| XLogP | 0.59 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.19 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|