C14H24IN3O3S — CID 111338818
1-[2-(2-methoxyphenyl)ethyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111338818) has the molecular formula C14H24IN3O3S and a molecular weight of 441.34 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenyl)ethyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2-methoxyphenyl)ethyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111338818 |
| Molecular Formula | C14H24IN3O3S |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 1-[2-(2-methoxyphenyl)ethyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccccc1OC)NCCS(C)(=O)=O.I |
| InChI | InChI=1S/C14H23N3O3S.HI/c1-15-14(17-10-11-21(3,18)19)16-9-8-12-6-4-5-7-13(12)20-2;/h4-7H,8-11H2,1-3H3,(H2,15,16,17);1H |
| InChIKey | UIZVDONCDJTYAW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|