C25H40O6 — CID 11133888
(2R,6R,7R,10S,12R,13R,14R,16R)-13-(methoxymethoxy)-4,4,7,17,18,18-hexamethyl-11-methylidene-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-ene-10,16-diol (PubChem CID 11133888) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is (2R,6R,7R,10S,12R,13R,14R,16R)-13-(methoxymethoxy)-4,4,7,17,18,18-hexamethyl-11-methylidene-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-ene-10,16-diol.
| Compound Name | (2R,6R,7R,10S,12R,13R,14R,16R)-13-(methoxymethoxy)-4,4,7,17,18,18-hexamethyl-11-methylidene-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-ene-10,16-diol |
|---|---|
| PubChem CID | 11133888 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | (2R,6R,7R,10S,12R,13R,14R,16R)-13-(methoxymethoxy)-4,4,7,17,18,18-hexamethyl-11-methylidene-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-ene-10,16-diol |
| SMILES | C=C1[C@@H](O)CC[C@@]2(C)[C@H]3OC(C)(C)O[C@@H]3C3=C(C)[C@H](O)C[C@@H]([C@@H](OCOC)[C@H]12)C3(C)C |
| InChI | InChI=1S/C25H40O6/c1-13-16(26)9-10-25(7)19(13)20(29-12-28-8)15-11-17(27)14(2)18(23(15,3)4)21-22(25)31-24(5,6)30-21/h15-17,19-22,26-27H,1,9-12H2,2-8H3/t15-,16-,17+,19-,20+,21+,22-,25+/m0/s1 |
| InChIKey | UQTDGYJEYKJIQU-WUOXHZNRSA-N |
| XLogP | 3.57 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|