C19H23N2O8P — CID 11133924
[(2R,3S,5R)-3-dimethoxyphosphoryl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate (PubChem CID 11133924) has the molecular formula C19H23N2O8P and a molecular weight of 438.37 g/mol. Its IUPAC name is [(2R,3S,5R)-3-dimethoxyphosphoryl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,5R)-3-dimethoxyphosphoryl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11133924 |
| Molecular Formula | C19H23N2O8P |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | [(2R,3S,5R)-3-dimethoxyphosphoryl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate |
| SMILES | COP(=O)(OC)[C@H]1C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H23N2O8P/c1-12-10-21(19(24)20-17(12)22)16-9-15(30(25,26-2)27-3)14(29-16)11-28-18(23)13-7-5-4-6-8-13/h4-8,10,14-16H,9,11H2,1-3H3,(H,20,22,24)/t14-,15+,16-/m1/s1 |
| InChIKey | NWNWGBWTNVOVRC-OWCLPIDISA-N |
| XLogP | 1.84 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|