C17H15BF6O2S2 — CID 11133962
[4-[2-(2,4-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethylthiophen-2-yl]boronic acid (PubChem CID 11133962) has the molecular formula C17H15BF6O2S2 and a molecular weight of 440.24 g/mol. Its IUPAC name is [4-[2-(2,4-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethylthiophen-2-yl]boronic acid.
| Compound Name | [4-[2-(2,4-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethylthiophen-2-yl]boronic acid |
|---|---|
| PubChem CID | 11133962 |
| Molecular Formula | C17H15BF6O2S2 |
| Molecular Weight | 440.24 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | [4-[2-(2,4-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethylthiophen-2-yl]boronic acid |
| SMILES | Cc1csc(C)c1C1=C(c2c(C)sc(B(O)O)c2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C17H15BF6O2S2/c1-6-5-27-8(3)10(6)12-13(16(21,22)17(23,24)15(12,19)20)11-7(2)14(18(25)26)28-9(11)4/h5,25-26H,1-4H3 |
| InChIKey | NXDNAYSUXFBZJD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.24 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|