C23H33IN4O2 — CID 111340080
N-[3-[[[N-[2-(2-methoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylbutanamide;hydroiodide (PubChem CID 111340080) has the molecular formula C23H33IN4O2 and a molecular weight of 524.45 g/mol. Its IUPAC name is N-[3-[[[N-[2-(2-methoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylbutanamide;hydroiodide.
| Compound Name | N-[3-[[[N-[2-(2-methoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylbutanamide;hydroiodide |
|---|---|
| PubChem CID | 111340080 |
| Molecular Formula | C23H33IN4O2 |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | N-[3-[[[N-[2-(2-methoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylbutanamide;hydroiodide |
| SMILES | CCC(C)C(=O)Nc1cccc(CN/C(=N/C)NCCc2ccccc2OC)c1.I |
| InChI | InChI=1S/C23H32N4O2.HI/c1-5-17(2)22(28)27-20-11-8-9-18(15-20)16-26-23(24-3)25-14-13-19-10-6-7-12-21(19)29-4;/h6-12,15,17H,5,13-14,16H2,1-4H3,(H,27,28)(H2,24,25,26);1H |
| InChIKey | HJQHTBOSNUDJNJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|