C22H29N5O2S — CID 111341141
1-[2-(benzylsulfamoyl)ethyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine (PubChem CID 111341141) has the molecular formula C22H29N5O2S and a molecular weight of 427.57 g/mol. Its IUPAC name is 1-[2-(benzylsulfamoyl)ethyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine.
| Compound Name | 1-[2-(benzylsulfamoyl)ethyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111341141 |
| Molecular Formula | C22H29N5O2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 1-[2-(benzylsulfamoyl)ethyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine |
| SMILES | C/N=C(/NCCCn1ccc2ccccc21)NCCS(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H29N5O2S/c1-23-22(24-13-7-15-27-16-12-20-10-5-6-11-21(20)27)25-14-17-30(28,29)26-18-19-8-3-2-4-9-19/h2-6,8-12,16,26H,7,13-15,17-18H2,1H3,(H2,23,24,25) |
| InChIKey | XEQOJPRVODCARU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 87.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|