C25H34N6O2 — CID 11134154
6-imidazol-1-yl-2-[7-[4-(2-methoxyphenyl)piperazin-1-yl]heptyl]pyridazin-3-one (PubChem CID 11134154) has the molecular formula C25H34N6O2 and a molecular weight of 450.59 g/mol. Its IUPAC name is 6-imidazol-1-yl-2-[7-[4-(2-methoxyphenyl)piperazin-1-yl]heptyl]pyridazin-3-one.
| Compound Name | 6-imidazol-1-yl-2-[7-[4-(2-methoxyphenyl)piperazin-1-yl]heptyl]pyridazin-3-one |
|---|---|
| PubChem CID | 11134154 |
| Molecular Formula | C25H34N6O2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 6-imidazol-1-yl-2-[7-[4-(2-methoxyphenyl)piperazin-1-yl]heptyl]pyridazin-3-one |
| SMILES | COc1ccccc1N1CCN(CCCCCCCn2nc(-n3ccnc3)ccc2=O)CC1 |
| InChI | InChI=1S/C25H34N6O2/c1-33-23-10-6-5-9-22(23)29-19-17-28(18-20-29)14-7-3-2-4-8-15-31-25(32)12-11-24(27-31)30-16-13-26-21-30/h5-6,9-13,16,21H,2-4,7-8,14-15,17-20H2,1H3 |
| InChIKey | KXDWILMTNQPDCR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 68.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|