C28H32N4O2 — CID 11134250
2-(2-aminoethyl)-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 11134250) has the molecular formula C28H32N4O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 2-(2-aminoethyl)-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 2-(2-aminoethyl)-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 11134250 |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 2-(2-aminoethyl)-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCNc1cc2c(cc1C)C1(c3cc(C)c(NCC)cc3O2)c2ccccc2C(=O)N1CCN |
| InChI | InChI=1S/C28H32N4O2/c1-5-30-23-15-25-21(13-17(23)3)28(22-14-18(4)24(31-6-2)16-26(22)34-25)20-10-8-7-9-19(20)27(33)32(28)12-11-29/h7-10,13-16,30-31H,5-6,11-12,29H2,1-4H3 |
| InChIKey | PQLZOOALVMFLCW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|