C24H33IN4O — CID 111342742
1-ethyl-2-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-(2-phenylpropyl)guanidine;hydroiodide (PubChem CID 111342742) has the molecular formula C24H33IN4O and a molecular weight of 520.46 g/mol. Its IUPAC name is 1-ethyl-2-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-(2-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-(2-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111342742 |
| Molecular Formula | C24H33IN4O |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 1-ethyl-2-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-(2-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(CN2CCCC2=O)c1)NCC(C)c1ccccc1.I |
| InChI | InChI=1S/C24H32N4O.HI/c1-3-25-24(26-16-19(2)22-11-5-4-6-12-22)27-17-20-9-7-10-21(15-20)18-28-14-8-13-23(28)29;/h4-7,9-12,15,19H,3,8,13-14,16-18H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | WZVGGIPBHPIUCT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|