About 1-[2-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-(2,5-difluorophenyl)urea
1-[2-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-(2,5-difluorophenyl)urea (PubChem CID 11134412) has the molecular formula C27H29F2N3O2
and a molecular weight of 465.54 g/mol. Its IUPAC name is 1-[2-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-(2,5-difluorophenyl)urea.
Molecular Properties
| Compound Name | 1-[2-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-(2,5-difluorophenyl)urea |
| PubChem CID | 11134412 |
| Molecular Formula | C27H29F2N3O2 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 1-[2-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-(2,5-difluorophenyl)urea |
| SMILES | O=C(Nc1cc(F)ccc1F)Nc1ccccc1C(O)CN1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H29F2N3O2/c28-21-10-11-23(29)25(17-21)31-27(34)30-24-9-5-4-8-22(24)26(33)18-32-14-12-20(13-15-32)16-19-6-2-1-3-7-19/h1-11,17,20,26,33H,12-16,18H2,(H2,30,31,34) |
| InChIKey | XINIMAZPUMKJHH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-(2,5-difluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-(2,5-difluorophenyl)urea?
The IUPAC name of 1-[2-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-(2,5-difluorophenyl)urea (CID 11134412) is 1-[2-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-(2,5-difluorophenyl)urea.
What is the SMILES notation for 1-[2-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-(2,5-difluorophenyl)urea?
The canonical SMILES for 1-[2-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-(2,5-difluorophenyl)urea is O=C(Nc1cc(F)ccc1F)Nc1ccccc1C(O)CN1CCC(Cc2ccccc2)CC1.
What is the InChIKey of 1-[2-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-(2,5-difluorophenyl)urea?
The InChIKey is XINIMAZPUMKJHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29F2N3O2/c28-21-10-11-23(29)25(17-21)31-27(34)30-24-9-5-4-8-22(24)26(33)18-32-14-12-20(13-15-32)16-19-6-2-1-3-7-19/h1-11,17,20,26,33H,12-16,18H2,(H2,30,31,34).
What are the key properties of 1-[2-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-(2,5-difluorophenyl)urea?
1-[2-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-(2,5-difluorophenyl)urea has a molecular weight of 465.54 g/mol, XLogP of 5.60, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-(2,5-difluorophenyl)urea is sourced from PubChem (CID 11134412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).