C19H37IO3Si — CID 11134460
tert-butyl-[2-[(4S,5S,6R)-6-[(Z)-4-iodobut-2-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]ethoxy]-dimethylsilane (PubChem CID 11134460) has the molecular formula C19H37IO3Si and a molecular weight of 468.49 g/mol. Its IUPAC name is tert-butyl-[2-[(4S,5S,6R)-6-[(Z)-4-iodobut-2-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(4S,5S,6R)-6-[(Z)-4-iodobut-2-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11134460 |
| Molecular Formula | C19H37IO3Si |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | tert-butyl-[2-[(4S,5S,6R)-6-[(Z)-4-iodobut-2-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]ethoxy]-dimethylsilane |
| SMILES | C/C(=C/CI)[C@@H]1OC(C)(C)O[C@@H](CCO[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C19H37IO3Si/c1-14(10-12-20)17-15(2)16(22-19(6,7)23-17)11-13-21-24(8,9)18(3,4)5/h10,15-17H,11-13H2,1-9H3/b14-10-/t15-,16-,17-/m0/s1 |
| InChIKey | QPHVGOWAMNVJRX-XZUCYQPYSA-N |
| XLogP | 5.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|