C15H25IN4OS — CID 111345010
N-ethyl-3-[[[N'-methyl-N-(2-methylsulfanylethyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111345010) has the molecular formula C15H25IN4OS and a molecular weight of 436.36 g/mol. Its IUPAC name is N-ethyl-3-[[[N'-methyl-N-(2-methylsulfanylethyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-ethyl-3-[[[N'-methyl-N-(2-methylsulfanylethyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111345010 |
| Molecular Formula | C15H25IN4OS |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | N-ethyl-3-[[[N'-methyl-N-(2-methylsulfanylethyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | CCNC(=O)c1cccc(CN/C(=N/C)NCCSC)c1.I |
| InChI | InChI=1S/C15H24N4OS.HI/c1-4-17-14(20)13-7-5-6-12(10-13)11-19-15(16-2)18-8-9-21-3;/h5-7,10H,4,8-9,11H2,1-3H3,(H,17,20)(H2,16,18,19);1H |
| InChIKey | DQNAMIADWYFQDL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|