C24H30N2O3 — CID 1113452
cyclohexyl (4R)-2,7,7-trimethyl-5-oxo-4-pyridin-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 1113452) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is cyclohexyl (4R)-2,7,7-trimethyl-5-oxo-4-pyridin-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | cyclohexyl (4R)-2,7,7-trimethyl-5-oxo-4-pyridin-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 1113452 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | cyclohexyl (4R)-2,7,7-trimethyl-5-oxo-4-pyridin-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CC1=C(C(=O)OC2CCCCC2)[C@H](c2cccnc2)C2=C(CC(C)(C)CC2=O)N1 |
| InChI | InChI=1S/C24H30N2O3/c1-15-20(23(28)29-17-9-5-4-6-10-17)21(16-8-7-11-25-14-16)22-18(26-15)12-24(2,3)13-19(22)27/h7-8,11,14,17,21,26H,4-6,9-10,12-13H2,1-3H3/t21-/m0/s1 |
| InChIKey | YNQKQKSPLBNSLS-NRFANRHFSA-N |
| XLogP | 4.56 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |