C32H32N2O2 — CID 11134566
9,10-bis(2,4,6-trimethylanilino)-2,3-dihydroanthracene-1,4-dione (PubChem CID 11134566) has the molecular formula C32H32N2O2 and a molecular weight of 476.62 g/mol. Its IUPAC name is 9,10-bis(2,4,6-trimethylanilino)-2,3-dihydroanthracene-1,4-dione.
| Compound Name | 9,10-bis(2,4,6-trimethylanilino)-2,3-dihydroanthracene-1,4-dione |
|---|---|
| PubChem CID | 11134566 |
| Molecular Formula | C32H32N2O2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 9,10-bis(2,4,6-trimethylanilino)-2,3-dihydroanthracene-1,4-dione |
| SMILES | Cc1cc(C)c(Nc2c3c(c(Nc4c(C)cc(C)cc4C)c4ccccc24)C(=O)CCC3=O)c(C)c1 |
| InChI | InChI=1S/C32H32N2O2/c1-17-13-19(3)29(20(4)14-17)33-31-23-9-7-8-10-24(23)32(28-26(36)12-11-25(35)27(28)31)34-30-21(5)15-18(2)16-22(30)6/h7-10,13-16,33-34H,11-12H2,1-6H3 |
| InChIKey | IJLPKRRUMIOTFC-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'} |
|---|