C19H28N6O — CID 111346603
1-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine (PubChem CID 111346603) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine.
| Compound Name | 1-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111346603 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 1-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1ccn[nH]1)NCC(c1cccc(OC)c1)N1CCCC1 |
| InChI | InChI=1S/C19H28N6O/c1-20-19(21-13-16-8-9-23-24-16)22-14-18(25-10-3-4-11-25)15-6-5-7-17(12-15)26-2/h5-9,12,18H,3-4,10-11,13-14H2,1-2H3,(H,23,24)(H2,20,21,22) |
| InChIKey | UIMHVMMQRSWKNM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|