C24H32N6O — CID 111346805
1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine (PubChem CID 111346805) has the molecular formula C24H32N6O and a molecular weight of 420.56 g/mol. Its IUPAC name is 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine.
| Compound Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111346805 |
| Molecular Formula | C24H32N6O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1nc2ccccc2[nH]1)NCC(c1cccc(OC)c1)N1CCCC1 |
| InChI | InChI=1S/C24H32N6O/c1-25-24(26-13-12-23-28-20-10-3-4-11-21(20)29-23)27-17-22(30-14-5-6-15-30)18-8-7-9-19(16-18)31-2/h3-4,7-11,16,22H,5-6,12-15,17H2,1-2H3,(H,28,29)(H2,25,26,27) |
| InChIKey | PGNXZPSXULGYKX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|